CAS 1245808-09-6: 5-[(2-Aminophenoxy)methyl]-2-furancarboxylic acid
Description:5-[(2-Aminophenoxy)methyl]-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and an amino group. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the 2-aminophenoxy moiety suggests that it may exhibit properties associated with both aromatic compounds and amines, such as hydrogen bonding and potential interactions with biological targets. Its molecular structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may serve as a scaffold for drug design. Additionally, the compound's solubility and stability in different solvents can influence its behavior in biological systems and chemical reactions. Overall, 5-[(2-Aminophenoxy)methyl]-2-furancarboxylic acid represents a versatile chemical entity with potential implications in research and industry, particularly in the fields of organic synthesis and drug development.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c13-9-3-1-2-4-10(9)16-7-8-5-6-11(17-8)12(14)15/h1-6H,7,13H2,(H,14,15)
InChI key:InChIKey=QMQQYVJXLOSFLY-UHFFFAOYSA-N
SMILES:O=C(O)C=1OC(=CC1)COC=2C=CC=CC2N
- Synonyms:
- 2-Furancarboxylic acid, 5-[(2-aminophenoxy)methyl]-
- 5-[(2-Aminophenoxy)methyl]-2-furancarboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-(2-Aminophenoxymethyl)furan-2-carboxylic acid REF: 3D-VZB80809CAS: 1245808-09-6 | Min. 95% | 263.00 €~2,332.00 € | Thu 08 May 25 |
![]() | 5-[(2-aminophenoxy)methyl]-2-furoic acid REF: 10-F428483CAS: 1245808-09-6 | 95.0% | - - - | Discontinued product |

5-(2-Aminophenoxymethyl)furan-2-carboxylic acid
Ref: 3D-VZB80809
50mg | 667.00 € | ||
500mg | 1,867.00 € |

5-[(2-aminophenoxy)methyl]-2-furoic acid
Ref: 10-F428483
1g | Discontinued | Request information | |
5g | Discontinued | Request information |