CAS 124845-04-1: 5-Cyclopropyl-4-isoxazolecarboxylic acid

Description:5-Cyclopropyl-4-isoxazolecarboxylic acid is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a cyclopropyl group contributes to its distinct properties, influencing its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids due to their ability to form hydrogen bonds. The carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. 5-Cyclopropyl-4-isoxazolecarboxylic acid has garnered interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with isoxazole moieties often exhibit significant pharmacological activities. Its specific interactions and mechanisms of action would depend on the context of its use and the biological targets involved.

Formula:C₇H₇NO₃

InChI:InChI=1S/C7H7NO3/c9-7(10)5-3-8-11-6(5)4-1-2-4/h3-4H,1-2H2,(H,9,10)

InChI key:InChIKey=KIJMAOMSRMPYIY-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=NOC1C2CC2

Synonyms:
4-Isoxazolecarboxylic acid, 5-cyclopropyl-
4-Isoxazolecarboxylicacid,5-cyclopropyl-(9CI)
5-Cyclopropyl-4-isoxazolecarboxylic acid
5-Cyclopropylisoxazole-4-Carboxylic Acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Isoxazolecarboxylic acid, 5-cyclopropyl- REF: IN-DA000MT7CAS: 124845-04-1	98%	53.00 €~619.00 €	Mon 03 Mar 25
5-Cyclopropylisoxazole-4-carboxylic acid REF: 54-OR922620CAS: 124845-04-1	97%	32.00 €~1,100.00 €	Tue 04 Mar 25
5-Cyclopropylisoxazole-4-carboxylic acid REF: 10-F635422CAS: 124845-04-1	98+%	To inquire	Thu 13 Mar 25
5-Cyclopropylisoxazole-4-carboxylic acid REF: 3D-ZEA84504CAS: 124845-04-1	Min. 95%	To inquire	Mon 14 Apr 25