CAS 125321-66-6: 2-Bromo-3-hexylthiophene homopolymer

Description: 2-Bromo-3-hexylthiophene homopolymer is a conjugated polymer derived from the polymerization of 2-bromo-3-hexylthiophene monomers. This substance exhibits characteristics typical of conducting polymers, including electrical conductivity, thermal stability, and the ability to form thin films. The presence of the bromine substituent enhances the polymer's reactivity, allowing for further functionalization or cross-linking, which can improve its mechanical properties. The hexyl side chain contributes to solubility in organic solvents, facilitating processing and application in various fields, such as organic electronics, photovoltaics, and sensors. Additionally, the thiophene units in the polymer backbone provide a planar structure that promotes π-π stacking, enhancing charge transport properties. The polymer's optical properties may also be tunable, making it suitable for applications in light-emitting devices. Overall, 2-Bromo-3-hexylthiophene homopolymer is a versatile material with potential applications in advanced electronic and optoelectronic devices.

Formula: (C₁₀H₁₅BrS)_x

InChI: InChI=1S/C10H15BrS/c1-2-3-4-5-6-9-7-8-12-10(9)11/h7-8H,2-6H2,1H3

InChI key: InChIKey=XQJNXCHDODCAJF-UHFFFAOYSA-N

SMILES: BrC=1SC=CC1CCCCCC

Poly(3-hexylthiophene-2,5-diyl) (regioregular) [for organic electronics]

CAS: 104934-50-1 110134-47-9 125321-66-6156074-98-5

• Color and Shape: Solid