
CAS 1254035-84-1: [5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl][3-[4-(2-oxa-6-azaspiro[3.3]hept-6-ylmethyl)phenoxy]-1-azetidinyl]methanone
Description:The chemical substance with the name "[5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl][3-[4-(2-oxa-6-azaspiro[3.3]hept-6-ylmethyl)phenoxy]-1-azetidinyl]methanone" and CAS number "1254035-84-1" is a complex organic compound characterized by its unique structural features, including an oxadiazole ring and an azetidine moiety. The presence of a methoxyphenyl group suggests potential aromatic interactions, while the spirocyclic structure may impart rigidity and influence the compound's three-dimensional conformation. This compound likely exhibits specific biological activities due to its intricate design, which may include interactions with biological targets or pathways. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular architecture. Such compounds are often explored in medicinal chemistry for their potential therapeutic applications, particularly in areas like cancer research or antimicrobial activity. Further studies would be necessary to elucidate its precise properties, including its pharmacokinetics and mechanism of action.
Formula:C25H26N4O5
InChI:InChI=1S/C25H26N4O5/c1-31-19-8-4-18(5-9-19)22-26-27-23(34-22)24(30)29-11-21(12-29)33-20-6-2-17(3-7-20)10-28-13-25(14-28)15-32-16-25/h2-9,21H,10-16H2,1H3
InChI key:InChIKey=BKKPIQPFRAPEAY-UHFFFAOYSA-N
SMILES:O=C(C1=NN=C(O1)C=2C=CC(OC)=CC2)N3CC(OC4=CC=C(C=C4)CN5CC6(COC6)C5)C3
- Synonyms:
- AZD1979
- (3-(4-(2-Oxa-6-azaspiro[3.3]heptan-6-ylmethyl)phenoxy)azetidin-1-yl)(5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl)methanone
- Methanone, [5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl][3-[4-(2-oxa-6-azaspiro[3.3]hept-6-ylmethyl)phenoxy]-1-azetidinyl]-
- AZD 1979
- [5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl][3-[4-(2-oxa-6-azaspiro[3.3]hept-6-ylmethyl)phenoxy]-1-azetidinyl]methanone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | AZD1979 REF: TM-T14372CAS: 1254035-84-1 | - - - | 62.00 € | Tue 25 Mar 25 |
![]() | [5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]-[3-[4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)phenoxy]azetidin-1-yl]methanone REF: 3D-EAC03584CAS: 1254035-84-1 | Min. 95% | 981.00 €~4,799.00 € | Thu 08 May 25 |

AZD1979
Ref: TM-T14372
1mg | 62.00 € |

[5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]-[3-[4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)phenoxy]azetidin-1-yl]methanone
Ref: 3D-EAC03584
1mg | 981.00 € | ||
5mg | 3,000.00 € | ||
10mg | 4,799.00 € |