![B-[2-(Propylthio)-5-(trifluoromethyl)-3-pyridinyl]boronic acid](https://static.cymitquimica.com/cas-image/155167-b-2-propylthio-5-trifluoromethyl-3-pyridinyl-boronic-acid.png)
CAS 1256345-56-8: B-[2-(Propylthio)-5-(trifluoromethyl)-3-pyridinyl]boronic acid
Description:B-[2-(Propylthio)-5-(trifluoromethyl)-3-pyridinyl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include a pyridine ring substituted with a propylthio group and a trifluoromethyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. Additionally, the propylthio substituent can affect the compound's solubility and reactivity. As a boronic acid, it may also participate in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds. Overall, this compound's unique functional groups and boronic acid characteristics make it a versatile building block in chemical research and development.
Formula:C9H11BF3NO2S
InChI:InChI=1S/C9H11BF3NO2S/c1-2-3-17-8-7(10(15)16)4-6(5-14-8)9(11,12)13/h4-5,15-16H,2-3H2,1H3
InChI key:InChIKey=HODNOVPEGNYLMV-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CN=C(SCCC)C(=C1)B(O)O
- Synonyms:
- Boronic acid, B-[2-(propylthio)-5-(trifluoromethyl)-3-pyridinyl]-
- B-[2-(Propylthio)-5-(trifluoromethyl)-3-pyridinyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Boronic acid, B-[2-(propylthio)-5-(trifluoromethyl)-3-pyridinyl]- REF: IN-DA000O09CAS: 1256345-56-8 | - - - | To inquire | Thu 27 Mar 25 |
 | 2-Propylthio-5-trifluoromethylpyridine-3-boronic acid REF: 54-PC412540CAS: 1256345-56-8 | - - - | To inquire | Fri 28 Mar 25 |
 | 2-Propylthio-5-trifluoromethylpyridine-3-boronic acid REF: 10-F622951CAS: 1256345-56-8 | 98% | - - - | Discontinued product |
 | 2-Propylthio-5-trifluoromethylpyridine-3-boronic acid REF: 3D-GAC34556CAS: 1256345-56-8 | Min. 95% | - - - | Discontinued product |
![Boronic acid, B-[2-(propylthio)-5-(trifluoromethyl)-3-pyridinyl]-](https://static.cymitquimica.com/products/IN/thumb/DA000O09.jpg)
Boronic acid, B-[2-(propylthio)-5-(trifluoromethyl)-3-pyridinyl]-
Ref: IN-DA000O09
| Undefined size | To inquire |
Ref: 54-PC412540
| Undefined size | To inquire |
2-Propylthio-5-trifluoromethylpyridine-3-boronic acid
Ref: 10-F622951
| 5g | Discontinued | Request information |
2-Propylthio-5-trifluoromethylpyridine-3-boronic acid
Ref: 3D-GAC34556
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
