CAS 1256345-91-1: 2-Borono-4,5-dimethoxybenzoic acid

Description:2-Borono-4,5-dimethoxybenzoic acid is an organic compound characterized by the presence of a boronic acid functional group and a substituted benzoic acid structure. It features two methoxy groups (-OCH3) attached to the benzene ring, which enhance its solubility and reactivity. The boron atom in the boronic acid moiety allows for unique reactivity, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The compound is typically a white to off-white solid and is soluble in polar organic solvents. Its acidity is attributed to the carboxylic acid group, which can donate a proton in solution. The presence of the boron atom also contributes to its ability to form complexes with various substrates, making it useful in the development of pharmaceuticals and agrochemicals. Overall, 2-Borono-4,5-dimethoxybenzoic acid is a versatile building block in synthetic organic chemistry, particularly in the synthesis of complex molecules.

Formula:C₉H₁₁BO₆

InChI:InChI=1S/C9H11BO6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4,13-14H,1-2H3,(H,11,12)

InChI key:InChIKey=WDKCKAPUQPJHJV-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(OC)=C(OC)C=C1B(O)O

Synonyms:
2-Borono-4,5-dimethoxybenzoic acid
Benzoic acid, 2-borono-4,5-dimethoxy-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 2-borono-4,5-dimethoxy- REF: IN-DA000O0OCAS: 1256345-91-1	- - -	To inquire	Thu 13 Mar 25
2-Carboxy-4,5-dimethoxyphenylboronic acid REF: 54-OR360871CAS: 1256345-91-1	- - -	To inquire	Fri 14 Mar 25
2-Carboxy-4,5-dimethoxyphenylboronic acid REF: 10-F623175CAS: 1256345-91-1	96%	- - -	Discontinued product
2-Carboxy-45-dimethoxyphenylboronic acid REF: 3D-GAC34591CAS: 1256345-91-1	Min. 95%	- - -	Discontinued product