CAS 1256345-91-1: 2-Borono-4,5-dimethoxybenzoic acid
Description:2-Borono-4,5-dimethoxybenzoic acid is an organic compound characterized by the presence of a boronic acid functional group and a substituted benzoic acid structure. It features two methoxy groups (-OCH3) attached to the benzene ring, which enhance its solubility and reactivity. The boron atom in the boronic acid moiety allows for unique reactivity, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The compound is typically a white to off-white solid and is soluble in polar organic solvents. Its acidity is attributed to the carboxylic acid group, which can donate a proton in solution. The presence of the boron atom also contributes to its ability to form complexes with various substrates, making it useful in the development of pharmaceuticals and agrochemicals. Overall, 2-Borono-4,5-dimethoxybenzoic acid is a versatile building block in synthetic organic chemistry, particularly in the synthesis of complex molecules.
Formula:C9H11BO6
InChI:InChI=1S/C9H11BO6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4,13-14H,1-2H3,(H,11,12)
InChI key:InChIKey=WDKCKAPUQPJHJV-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(OC)=C(OC)C=C1B(O)O
- Synonyms:
- 2-Borono-4,5-dimethoxybenzoic acid
- Benzoic acid, 2-borono-4,5-dimethoxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzoic acid, 2-borono-4,5-dimethoxy- REF: IN-DA000O0OCAS: 1256345-91-1 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-Carboxy-4,5-dimethoxyphenylboronic acid REF: 54-OR360871CAS: 1256345-91-1 | - - - | To inquire | Fri 28 Mar 25 |
![]() | 2-Carboxy-4,5-dimethoxyphenylboronic acid REF: 10-F623175CAS: 1256345-91-1 | 96% | - - - | Discontinued product |
![]() | 2-Carboxy-45-dimethoxyphenylboronic acid REF: 3D-GAC34591CAS: 1256345-91-1 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA000O0O
Undefined size | To inquire |

Ref: 54-OR360871
Undefined size | To inquire |

2-Carboxy-4,5-dimethoxyphenylboronic acid
Ref: 10-F623175
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-Carboxy-45-dimethoxyphenylboronic acid
Ref: 3D-GAC34591
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |