CAS 1256345-96-6: B-[3-Butoxy-5-(trifluoromethoxy)phenyl]boronic acid

Description:B-[3-Butoxy-5-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a butoxy group and a trifluoromethoxy group, which contribute to its unique chemical properties, including enhanced lipophilicity and potential biological activity. The trifluoromethoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with biological targets. Additionally, boronic acids are often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in organic synthesis. The presence of the boronic acid moiety also allows for the potential application in drug development, particularly in the design of inhibitors for various enzymes. Overall, this compound exemplifies the versatility of boronic acids in both synthetic and pharmaceutical chemistry.

Formula:C₁₁H₁₄BF₃O₄

InChI:InChI=1S/C11H14BF3O4/c1-2-3-4-18-9-5-8(12(16)17)6-10(7-9)19-11(13,14)15/h5-7,16-17H,2-4H2,1H3

InChI key:InChIKey=LJAITWONDCKJGB-UHFFFAOYSA-N

SMILES:FC(F)(F)OC1=CC(OCCCC)=CC(=C1)B(O)O

Synonyms:
Boronic acid, B-[3-butoxy-5-(trifluoromethoxy)phenyl]-
B-[3-Butoxy-5-(trifluoromethoxy)phenyl]boronic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-[3-butoxy-5-(trifluoromethoxy)phenyl]- REF: IN-DA000O0JCAS: 1256345-96-6	97%	128.00 €~270.00 €	Tue 11 Mar 25
3-Butoxy-5-(trifluoromethoxy)phenylboronic acid REF: 54-PC412192CAS: 1256345-96-6	- - -	To inquire	Wed 12 Mar 25
(3-Butoxy-5-(trifluoromethoxy)phenyl)boronic acid REF: 10-F228584CAS: 1256345-96-6	95.0%	- - -	Discontinued product
3-Butoxy-5-(trifluoroMethoxy)phenylboronic acid REF: 3D-FB90818CAS: 1256345-96-6	Min. 95%	- - -	Discontinued product