
CAS 1256346-38-9: Boronic acid, B-1H-pyrazol-4-yl-, hydrochloride (1:1)
Description:Boronic acid, B-1H-pyrazol-4-yl-, hydrochloride (1:1) is a chemical compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits properties associated with both boronic acids and pyrazoles, including the ability to form reversible covalent bonds with diols, which is significant in various applications such as drug development and materials science. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it more stable for handling and storage. Boronic acids are known for their role in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. Additionally, the pyrazole moiety may impart biological activity, making this compound of interest in medicinal chemistry. Overall, this substance is valuable in synthetic organic chemistry and potentially in pharmaceutical applications due to its unique reactivity and structural features.
Formula:C3H5BN2O2·ClH
InChI:InChI=1S/C3H5BN2O2.ClH/c7-4(8)3-1-5-6-2-3;/h1-2,7-8H,(H,5,6);1H
InChI key:InChIKey=CRKPOXLJKQYRQE-UHFFFAOYSA-N
SMILES:Cl.OB(O)C=1C=NNC1
- Synonyms:
- (1H-Pyrazol-4-yl)boronic acid hydrochloride
- Boronic acid, B-1H-pyrazol-4-yl-, hydrochloride (1:1)
- Pyrazole-4-boronic acid hydrochloride salt

Boronic acid, B-1H-pyrazol-4-yl-, hydrochloride (1:1)
Ref: IN-DA000O2A
1g | 141.00 € | ||
250mg | 67.00 € |

Ref: 54-OR907351
1g | 182.00 € | ||
5g | 635.00 € | ||
250mg | 86.00 € |

Ref: 4Z-P-303009
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(1h-Pyrazol-4-yl)boronic acid hydrochloride
Ref: 10-F691620
1g | To inquire | ||
250mg | To inquire |

1H-Pyrazole-4-boronic acid hydrochloride
Ref: 3D-FP46112
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |