![B-[4-[Bis(acetyloxy)methyl]phenyl]boronic acid](https://static.cymitquimica.com/cas-image/226226-b-4-bis-acetyloxy-methyl-phenyl-boronic-acid.png)
CAS 1256346-39-0: B-[4-[Bis(acetyloxy)methyl]phenyl]boronic acid
Description:B-[4-[Bis(acetyloxy)methyl]phenyl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with two acetyloxy methyl groups. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The acetyloxy groups enhance its solubility and reactivity, allowing for potential applications in drug delivery and as a building block in the synthesis of more complex molecules. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The presence of the acetyloxy groups may also influence the compound's stability and reactivity under different conditions. Overall, B-[4-[Bis(acetyloxy)methyl]phenyl]boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C11H13BO6
InChI:InChI=1S/C11H13BO6/c1-7(13)17-11(18-8(2)14)9-3-5-10(6-4-9)12(15)16/h3-6,11,15-16H,1-2H3
InChI key:InChIKey=WQQIEDWQBJYVAE-UHFFFAOYSA-N
SMILES:O=C(OC(OC(=O)C)C1=CC=C(C=C1)B(O)O)C
- Synonyms:
- Boronic acid, B-[4-[bis(acetyloxy)methyl]phenyl]-
- B-[4-[Bis(acetyloxy)methyl]phenyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Boronic acid, B-[4-[bis(acetyloxy)methyl]phenyl]- REF: IN-DA000O29CAS: 1256346-39-0 | - - - | To inquire | Thu 27 Mar 25 |
 | 4-(Diacetoxymethyl)phenylboronic acid REF: 54-OR361092CAS: 1256346-39-0 | - - - | To inquire | Fri 28 Mar 25 |
 | 4-(Diacetoxymethyl)phenylboronic acid REF: 10-F623309CAS: 1256346-39-0 | 98% | - - - | Discontinued product |
 | 4-(Diacetoxymethyl)phenylboronic acid REF: 3D-FD160251CAS: 1256346-39-0 | Min. 95% | - - - | Discontinued product |
![Boronic acid, B-[4-[bis(acetyloxy)methyl]phenyl]-](https://static.cymitquimica.com/products/IN/thumb/DA000O29.jpg)
Boronic acid, B-[4-[bis(acetyloxy)methyl]phenyl]-
Ref: IN-DA000O29
| Undefined size | To inquire |
Ref: 54-OR361092
| Undefined size | To inquire |
Ref: 10-F623309
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
4-(Diacetoxymethyl)phenylboronic acid
Ref: 3D-FD160251
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
