CAS 1256355-07-3: B-(2-Butoxy-4-chlorophenyl)boronic acid

Description:B-(2-Butoxy-4-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorophenyl moiety. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the butoxy group enhances its solubility and stability, while the chlorophenyl group can influence its reactivity and biological activity. This compound may be utilized in the development of pharmaceuticals, particularly in the synthesis of compounds that target specific biological pathways. Additionally, its properties make it a candidate for use in materials science, particularly in the development of sensors or catalysts. As with many boronic acids, it is essential to handle this compound with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.

Formula:C₁₀H₁₄BClO₃

InChI:InChI=1S/C10H14BClO3/c1-2-3-6-15-10-7-8(12)4-5-9(10)11(13)14/h4-5,7,13-14H,2-3,6H2,1H3

InChI key:InChIKey=YYWQEIZDBBRJAQ-UHFFFAOYSA-N

SMILES:ClC1=CC=C(B(O)O)C(OCCCC)=C1

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-(2-butoxy-4-chlorophenyl)- REF: IN-DA000O2NCAS: 1256355-07-3	- - -	To inquire	Mon 10 Mar 25
2-Butoxy-4-chlorophenylboronic acid REF: 54-OR360537CAS: 1256355-07-3	- - -	To inquire	Tue 11 Mar 25
(2-Butoxy-4-chlorophenyl)boronic acid REF: 10-F228615CAS: 1256355-07-3	95.0%	- - -	Discontinued product
2-Butoxy-4-chlorophenylboronic acid REF: 3D-GAC35507CAS: 1256355-07-3	Min. 95%	- - -	Discontinued product