CAS 1256360-33-4: 4-Chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Description:4-Chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a complex organic compound characterized by its unique structural features, which include an indole core, a chloro substituent, and a silyl group. The presence of the dimethylsilyl group enhances the compound's stability and solubility, while the boron-containing dioxaborolane moiety is significant for its potential applications in organic synthesis and medicinal chemistry. This compound may exhibit interesting electronic properties due to the conjugation within the indole structure and the influence of the boron atom. Additionally, the bulky tert-butyl group contributes to steric hindrance, which can affect reactivity and interactions with other molecules. Overall, this compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential utility in chemical reactions and as a building block for more complex molecules. Its specific reactivity and applications would depend on further experimental studies.
Formula:C20H31BClNO2Si
InChI:InChI=1S/C20H31BClNO2Si/c1-18(2,3)26(8,9)23-11-10-15-16(22)12-14(13-17(15)23)21-24-19(4,5)20(6,7)25-21/h10-13H,1-9H3
InChI key:InChIKey=DWJFWJLFXHFVQO-UHFFFAOYSA-N
SMILES:ClC1=CC(=CC2=C1C=CN2[Si](C)(C)C(C)(C)C)B3OC(C)(C)C(O3)(C)C
- Synonyms:
- 1H-Indole, 4-chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1-(tert-Butyldimethylsilyl)-4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
- 4-Chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

1H-Indole, 4-chloro-1-[(1,1-dimethylethyl)dimethylsilyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Ref: IN-DA000O7J
Undefined size | To inquire |

1-(tert-Butyldimethylsilyl)-4-chloroindole-6-boronic acid, pinacol ester
Ref: 54-OR360848
Undefined size | To inquire |

1-(tert-Butyldimethylsilyl)-4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Ref: 10-F238028
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

1-(t-Butyldimethylsilyl)-4-chloroindole-6-boronic acid pinacol ester
Ref: 3D-GAC36033
500mg | Discontinued | Request information |