CAS 1256482-65-1: 3-Fluoro-2-methoxyphenylalanine
Description:3-Fluoro-2-methoxyphenylalanine, identified by its CAS number 1256482-65-1, is an amino acid derivative characterized by the presence of a fluorine atom and a methoxy group on the phenyl ring of the phenylalanine structure. This compound features a chiral center, which contributes to its potential biological activity and interactions. The fluorine substitution can influence the compound's lipophilicity, stability, and binding affinity to biological targets, making it of interest in medicinal chemistry and drug design. The methoxy group may enhance solubility and alter the electronic properties of the molecule. As a phenylalanine derivative, it retains the basic structure of amino acids, including an amino group, a carboxylic acid group, and a side chain that distinguishes it from other amino acids. This compound may be studied for its potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents targeting specific biological pathways. Its unique structural features make it a valuable subject for research in both organic and medicinal chemistry.
Formula:C10H12FNO3
InChI:InChI=1S/C10H12FNO3/c1-15-9-6(3-2-4-7(9)11)5-8(12)10(13)14/h2-4,8H,5,12H2,1H3,(H,13,14)
InChI key:InChIKey=DZDIMQMNUOMEAX-UHFFFAOYSA-N
SMILES:O=C(O)C(N)CC=1C=CC=C(F)C1OC
- Synonyms:
- 3-Fluoro-2-methoxy-dl-phenylalanine
- 3-Fluoro-2-methoxy-DL-phenyLalanine
- 3-Fluoro-2-methoxyphenylalanine
- 2-Amino-3-(3-fluoro-2-methoxyphenyl)propanoic acid
- Phenylalanine, 3-fluoro-2-methoxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Fluoro-2-methoxy-DL-phenylalanine REF: 54-PC303123CAS: 1256482-65-1 | - - - | 279.00 €~807.00 € | Fri 28 Mar 25 |
![]() | 3-Fluoro-2-methoxy-DL-phenylalanine REF: 10-F342943CAS: 1256482-65-1 | 95+% | - - - | Discontinued product |
![]() | 2-Amino-3-(3-fluoro-2-methoxyphenyl)propanoic acid REF: 3D-GAC48265CAS: 1256482-65-1 | Min. 95% | - - - | Discontinued product |

3-Fluoro-2-methoxy-DL-phenylalanine
Ref: 54-PC303123
1g | 279.00 € | ||
5g | 807.00 € |

3-Fluoro-2-methoxy-DL-phenylalanine
Ref: 10-F342943
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

2-Amino-3-(3-fluoro-2-methoxyphenyl)propanoic acid
Ref: 3D-GAC48265
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |