CAS 1256790-85-8: 5-Bromo-4-chloro-3-pyridinecarboxylic acid

Description:5-Bromo-4-chloro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring, along with a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. The presence of halogen atoms (bromine and chlorine) can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the pyridine ring contributes to its aromatic stability and may affect its electronic properties, making it useful in medicinal chemistry and agrochemical applications. The compound's unique structure may also impart specific biological activities, which can be explored in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula:C₆H₃BrClNO₂

InChI:InChI=1S/C6H3BrClNO2/c7-4-2-9-1-3(5(4)8)6(10)11/h1-2H,(H,10,11)

InChI key:InChIKey=AEYIMKNQTWXCNI-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=NC=C(Br)C1Cl

Synonyms:
3-Pyridinecarboxylic acid, 5-bromo-4-chloro-
5-Bromo-4-chloro-3-pyridinecarboxylic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Pyridinecarboxylic acid, 5-bromo-4-chloro- REF: IN-DA000ODGCAS: 1256790-85-8	97%	To inquire	Thu 27 Mar 25
5-Bromo-4-chloronicotinic acid REF: 54-OR78255CAS: 1256790-85-8	95%	269.00 €~2,368.00 €	Fri 28 Mar 25
5-Bromo-4-chloronicotinic acid REF: FT-B15683CAS: 1256790-85-8	>95%	To inquire	Tue 01 Apr 25
5-Bromo-4-chloronicotinic acid REF: 10-F450179CAS: 1256790-85-8	95.0%	117.00 €~1,223.00 €	Tue 01 Apr 25
5-Bromo-4-chloronicotinic acid REF: 3D-GAC79085CAS: 1256790-85-8	Min. 95%	- - -	Discontinued product