CAS 1256809-64-9: 5-Bromo-2-chloro-6-methyl-3-pyridinecarboxylic acid
Description:5-Bromo-2-chloro-6-methyl-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at various positions. The presence of bromine and chlorine atoms introduces halogen functionalities, which can influence the compound's reactivity and solubility. The methyl group contributes to the overall hydrophobic character, while the carboxylic acid functional group (-COOH) imparts acidic properties, allowing for potential interactions in biological systems or chemical reactions. This compound may exhibit polar characteristics due to the carboxylic acid, making it soluble in polar solvents. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The specific arrangement of substituents can also affect its biological activity, making it of interest in medicinal chemistry. As with many pyridine derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.
Formula:C7H5BrClNO2
InChI:InChI=1S/C7H5BrClNO2/c1-3-5(8)2-4(7(11)12)6(9)10-3/h2H,1H3,(H,11,12)
InChI key:InChIKey=GCRXOERAOBJTJI-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(Br)C(=NC1Cl)C
- Synonyms:
- 3-Pyridinecarboxylic acid, 5-bromo-2-chloro-6-methyl-
- 5-Bromo-2-chloro-6-methyl-3-pyridinecarboxylic acid

5-BroMo-2-chloro-6-Methyl-nicotinic acid
Ref: IN-DA009W7Q
100mg | 84.00 € | ||
250mg | 155.00 € |

5-Bromo-2-chloro-6-methylnicotinic acid
Ref: 10-F519628
1g | 528.00 € | ||
100mg | 72.00 € | ||
250mg | 152.00 € |

5-bromo-2-chloro-6-methylpyridine-3-carboxylic acid
Ref: 3D-GAC80964
1g | 841.00 € | ||
100mg | 394.00 € |