CAS 1257535-46-8: 7-Bromo-4-methyl-1H-indazole
Description:7-Bromo-4-methyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of a bromine atom at the 7-position and a methyl group at the 4-position contributes to its unique properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for various biological activities. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in synthetic organic chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-5-2-3-7(9)8-6(5)4-10-11-8/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=QOYOLKAXXZIJRY-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=2C=NNC12)C
- Synonyms:
- 1H-Indazole, 7-bromo-4-methyl-
- 7-Bromo-4-methyl-1H-indazole

1H-Indazole, 7-bromo-4-methyl-
Ref: IN-DA000OLY
1g | 508.00 € | ||
100mg | 163.00 € | ||
250mg | 267.00 € | ||
500mg | 503.00 € |

Ref: 10-F457869
1g | To inquire |

7-Bromo-4-methyl-1H-indazole
Ref: 3D-HAC53546
1g | 946.00 € | ||
100mg | 434.00 € |