CAS 125760-26-1: 2-oxo-2-phenylethyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serinate
Description:2-Oxo-2-phenylethyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serinate, with CAS number 125760-26-1, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a phenyl group and a serine moiety, which contribute to its potential biological activity. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates that it is likely used in peptide synthesis as a protective group for the amino acid, allowing for selective reactions during the synthesis process. The compound is characterized by its stability under standard laboratory conditions, but it may be sensitive to moisture and light, necessitating careful handling and storage. Its structure suggests potential applications in medicinal chemistry, particularly in the development of peptide-based therapeutics. Additionally, the compound may exhibit specific interactions with biological targets due to the presence of the serine residue, which can participate in hydrogen bonding and other molecular interactions. Overall, this compound represents a valuable tool in organic synthesis and drug development.
Formula:C26H23NO6
InChI:InChI=1/C26H23NO6/c28-14-23(25(30)32-16-24(29)17-8-2-1-3-9-17)27-26(31)33-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23,28H,14-16H2,(H,27,31)/t23-/m0/s1
- Synonyms:
- Fmoc-Ser-OPAC
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 2-oxo-2-phenylethyl ester REF: IN-DA000ON6CAS: 125760-26-1 | 98% | To inquire | Thu 27 Mar 25 |
![]() | N-(9-Fluorenylmethoxycarbonyl)-L-serine phenacyl ester REF: 7W-GM2723CAS: 125760-26-1 | - - - | To inquire | Fri 28 Mar 25 |
![]() | Fmoc-Ser-OPAC REF: 3D-FF72200CAS: 125760-26-1 | Min. 95% | - - - | Discontinued product |

L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 2-oxo-2-phenylethyl ester
Ref: IN-DA000ON6
Undefined size | To inquire |

Fmoc-Ser-OPAC
Ref: 3D-FF72200
25g | Discontinued | Request information |