CAS 1257637-80-1: 4-Bromo-3-cyclopropyl-1-methyl-1H-pyrazole

Description: 4-Bromo-3-cyclopropyl-1-methyl-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which consists of two adjacent nitrogen atoms within a five-membered ring. The presence of a bromine atom at the 4-position and a cyclopropyl group at the 3-position contributes to its unique chemical properties and reactivity. The methyl group at the 1-position enhances its lipophilicity, potentially influencing its biological activity. This compound is typically used in medicinal chemistry and may exhibit various pharmacological effects due to its structural features. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of the bromine atom can facilitate further chemical modifications, enhancing its utility in synthetic applications. As with many pyrazole derivatives, it may also exhibit interesting properties such as anti-inflammatory or anti-cancer activities, although specific biological activities would depend on further empirical studies. Proper handling and safety measures should be observed due to the presence of bromine, which can be hazardous.

Formula: C₇H₉BrN₂

InChI: InChI=1S/C7H9BrN2/c1-10-4-6(8)7(9-10)5-2-3-5/h4-5H,2-3H2,1H3

InChI key: InChIKey=USPQGAVLHGQJJV-UHFFFAOYSA-N

SMILES: BrC1=CN(N=C1C2CC2)C

Synonyms:

• 4-Bromo-3-cyclopropyl-1-methyl-1H-pyrazole
• 1H-Pyrazole, 4-bromo-3-cyclopropyl-1-methyl-

4-Bromo-3-cyclopropyl-1-methyl-1H-pyrazole

CAS: 1257637-80-1

Versatile small molecule scaffold

• Formula: C₇H₉BrN₂
• Purity: Min. 95%
• Molecular weight: 201.06 g/mol

4-bromo-3-cyclopropyl-1-methyl-1H-pyrazole

CAS: 1257637-80-1

• Molecular weight: 201.06700134277344