CAS 1257665-01-2: 5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 5-position and a hydroxyl group at the 4′-position on one of the phenyl rings contributes to its unique chemical properties, including potential biological activity. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting interactions in biological systems, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various potential applications, including as a building block in organic synthesis or as a ligand in coordination chemistry. Additionally, the presence of both electron-withdrawing (fluorine) and electron-donating (hydroxyl) groups can influence its reactivity and stability, making it a subject of study in both theoretical and applied chemistry contexts.
Formula:C13H9FO3
InChI:InChI=1S/C13H9FO3/c14-11-6-9(5-10(7-11)13(16)17)8-1-3-12(15)4-2-8/h1-7,15H,(H,16,17)
InChI key:InChIKey=AHDOCVLIQKICRL-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(F)C=C(C1)C=2C=CC(O)=CC2
- Synonyms:
- 5-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-4′-hydroxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [1,1'-Biphenyl]-3-carboxylic acid, 5-fluoro-4'-hydroxy- REF: IN-DA000OOBCAS: 1257665-01-2 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 5-Fluoro-4'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid REF: 10-F237288CAS: 1257665-01-2 | 95.0% | - - - | Discontinued product |
![]() | 5-Fluoro-4'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid REF: 3D-HAC66501CAS: 1257665-01-2 | Min. 95% | - - - | Discontinued product |

[1,1'-Biphenyl]-3-carboxylic acid, 5-fluoro-4'-hydroxy-
Ref: IN-DA000OOB
Undefined size | To inquire |

5-Fluoro-4'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid
Ref: 10-F237288
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

5-Fluoro-4'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid
Ref: 3D-HAC66501
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |