CAS 125829-24-5: chromoionophore I
Description:Chromoionophore I, with the CAS number 125829-24-5, is a synthetic chemical compound known for its role as a selective ionophore, particularly for cations. It exhibits a unique ability to facilitate the transport of specific ions across lipid membranes, making it valuable in various biochemical applications, including ion-selective electrodes and sensors. The compound typically features a chromophoric group that allows for optical detection, enabling the monitoring of ion concentrations through colorimetric changes. Its structure often includes functional groups that enhance solubility and ion-binding properties, contributing to its effectiveness in ion transport. Additionally, Chromoionophore I is utilized in research settings to study ion dynamics in biological systems and can be incorporated into various materials for sensing applications. Safety and handling precautions are essential when working with this compound, as with many synthetic chemicals, due to potential toxicity or reactivity. Overall, Chromoionophore I represents a significant tool in analytical chemistry and biochemistry for studying ion transport mechanisms.
Formula:C38H53N3O2
InChI:InChI=1/C38H53N3O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-37(42)39-34-29-36-38(32-24-22-21-23-31(32)34)40-33-27-26-30(28-35(33)43-36)41(5-2)6-3/h21-24,26-29H,4-20,25H2,1-3H3/b39-34-
- Synonyms:
- N,N-Diethyl-5-octyldecanoylimino-5H-benzo[a]phenoxazin-9-amine ETH 5294
- N-Octadecanoyl-Nile blue
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Octadecanamide, N-[9-(diethylamino)-5H-benzo[a]phenoxazin-5-ylidene]- REF: IN-DA000OT4CAS: 125829-24-5 | 98% | To inquire | Thu 27 Mar 25 |
![]() | Chromoionophore I REF: 7W-GT1771CAS: 125829-24-5 | - - - | 198.00 €~1,217.00 € | Thu 03 Apr 25 |

Octadecanamide, N-[9-(diethylamino)-5H-benzo[a]phenoxazin-5-ylidene]-
Ref: IN-DA000OT4
10mg | 495.00 € | ||
50mg | To inquire |

Ref: 7W-GT1771
10mg | 198.00 € | ||
20mg | 327.00 € | ||
100mg | 1,217.00 € |