CAS 1258650-12-2: 4-Chloro-1-ethyl-1H-pyrrole-2-carboxylic acid

Description: 4-Chloro-1-ethyl-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a chloro substituent at the fourth position and an ethyl group at the first position of the pyrrole ring contributes to its unique chemical properties. The carboxylic acid functional group at the second position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its solubility in polar solvents is likely due to the carboxylic acid group, while the chloro and ethyl groups may influence its lipophilicity and overall molecular interactions. As with many pyrrole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₈ClNO₂

InChI: InChI=1S/C7H8ClNO2/c1-2-9-4-5(8)3-6(9)7(10)11/h3-4H,2H2,1H3,(H,10,11)

InChI key: InChIKey=QOQIVKRHJNMVAZ-UHFFFAOYSA-N

SMILES: O=C(O)C1=CC(Cl)=CN1CC

4-Chloro-1-ethyl-1H-pyrrole-2-carboxylic acid

CAS: 1258650-12-2

Versatile small molecule scaffold

• Formula: C₇H₈ClNO₂
• Purity: Min. 95%
• Molecular weight: 173.6 g/mol

4-Chloro-1-ethyl-1h-pyrrole-2-carboxylic acid

CAS: 1258650-12-2

• Purity: 95%
• Molecular weight: 173.60000610351562