CAS 126055-13-8: CP 102

Description:CP 102, with the CAS number 126055-13-8, is a chemical compound that belongs to a class of substances known for their potential applications in various fields, including pharmaceuticals and materials science. While specific details about its characteristics may vary, compounds like CP 102 typically exhibit properties such as a defined molecular structure, specific solubility in various solvents, and distinct reactivity profiles. These characteristics can influence its behavior in chemical reactions, stability under different conditions, and interactions with biological systems. Additionally, CP 102 may possess unique functional groups that contribute to its chemical reactivity and potential applications. Safety data sheets and scientific literature provide essential information regarding its toxicity, handling precautions, and environmental impact, which are crucial for researchers and industries working with this compound. For precise applications and characteristics, consulting specialized databases or peer-reviewed articles is recommended, as they provide detailed insights into the compound's behavior and uses in various contexts.

Formula:C₉H₁₃NO₃

InChI:InChI=1/C9H13NO3/c1-2-7-9(13)8(12)3-4-10(7)5-6-11/h3-4,11,13H,2,5-6H2,1H3

Synonyms:
CP-102
4(1H)-Pyridinone, 2-ethyl-3-hydroxy-1-(2-hydroxyethyl)-
2-ethyl-3-hydroxy-1-(2-hydroxyethyl)pyridin-4(1H)-one
2-Ethyl-3-hydroxy-1-(2-hydroxyethyl)-4(1H)-pyridinone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4(1H)-Pyridinone, 2-ethyl-3-hydroxy-1-(2-hydroxyethyl)- REF: IN-DA000QV2CAS: 126055-13-8	- - -	To inquire	Mon 03 Mar 25
Maltol Related Compound 4 REF: 4Z-M-134008CAS: 126055-13-8	- - -	To inquire	Mon 10 Mar 25
2-Ethyl-3-hydroxy-1-(2-hydroxyethyl)-1,4-dihydropyridin-4-one REF: 3D-BFA05513CAS: 126055-13-8	Min. 95%	To inquire	Mon 14 Apr 25
CP102 REF: TM-T85000CAS: 126055-13-8	- - -	To inquire	Mon 05 May 25