CAS 1260658-89-6: 1-Methyl-3-nitro-1H-pyrazole-5-acetic acid
Description:1-Methyl-3-nitro-1H-pyrazole-5-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a nitro group, contributing to its unique reactivity and properties. The presence of the acetic acid functional group indicates that it can exhibit acidic behavior, making it potentially useful in various chemical reactions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. Overall, 1-Methyl-3-nitro-1H-pyrazole-5-acetic acid is a versatile compound with potential applications in both synthetic chemistry and medicinal chemistry.
Formula:C6H7N3O4
InChI:InChI=1S/C6H7N3O4/c1-8-4(3-6(10)11)2-5(7-8)9(12)13/h2H,3H2,1H3,(H,10,11)
InChI key:InChIKey=UQCHCOCUBDFNIT-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC(=NN1C)N(=O)=O
- Synonyms:
- 1-Methyl-3-nitro-1H-pyrazole-5-acetic acid
- 1H-Pyrazole-5-acetic acid, 1-methyl-3-nitro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(1-Methyl-3-nitro-1H-pyrazol-5-yl)acetic acid REF: 3D-KAC65889CAS: 1260658-89-6 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | (1-methyl-3-nitro-1H-pyrazol-5-yl)acetic acid REF: 10-F428868CAS: 1260658-89-6 | - - - | - - - | Discontinued product |

2-(1-Methyl-3-nitro-1H-pyrazol-5-yl)acetic acid
Ref: 3D-KAC65889
50mg | 807.00 € | ||
500mg | 2,405.00 € |

Ref: 10-F428868
1g | Discontinued | Request information |