CAS 1260674-55-2: 1,1-Dimethylethyl N-[(3-oxocyclopentyl)methyl]carbamate
Description:1,1-Dimethylethyl N-[(3-oxocyclopentyl)methyl]carbamate, identified by its CAS number 1260674-55-2, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound contains a dimethyl group, indicating the presence of two methyl groups attached to a tertiary carbon, which contributes to its steric bulk. Additionally, the presence of a cyclopentyl ring with a ketone functional group (3-oxo) suggests potential reactivity and interactions typical of cyclic ketones. The molecular structure implies that it may exhibit specific biological activities, making it of interest in fields such as medicinal chemistry or agrochemicals. Its physical properties, such as solubility and stability, would depend on the overall molecular structure and functional groups present. Safety and handling considerations would also be essential due to the potential toxicity associated with carbamate compounds.
Formula:C11H19NO3
InChI:InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-7-8-4-5-9(13)6-8/h8H,4-7H2,1-3H3,(H,12,14)
InChI key:InChIKey=OAOABSXMRINSEL-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)NCC1CC(=O)CC1
- Synonyms:
- 1,1-Dimethylethyl N-[(3-oxocyclopentyl)methyl]carbamate
- Carbamic acid, N-[(3-oxocyclopentyl)methyl]-, 1,1-dimethylethyl ester

Tert-Butyl (3-Oxocyclopentyl)Methylcarbamate
Ref: IN-DA00HITZ
1g | To inquire | ||
100mg | 630.00 € | ||
250mg | To inquire | ||
500mg | To inquire |

TERT-BUTYL (3-OXOCYCLOPENTYL)METHYLCARBAMATE
Ref: 10-F469248
1g | To inquire | ||
2g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

Tert-Butyl (3-Oxocyclopentyl)Methylcarbamate
Ref: 3D-KAC67455
250mg | 443.00 € | ||
2500mg | 1,113.00 € |