CAS 126120-87-4: 2,2-DIFLUORO-BENZO[1,3]DIOXOLE-4-BORONIC ACID

Description:2,2-Difluoro-benzo[1,3]dioxole-4-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a dioxole ring structure. This compound features two fluorine atoms attached to the benzene ring, which can influence its electronic properties and reactivity. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of fluorine atoms typically enhances the compound's lipophilicity and can improve its biological activity. Additionally, the unique structure of the dioxole ring contributes to its stability and potential utility in materials science, particularly in the development of organic semiconductors and sensors. Overall, 2,2-difluoro-benzo[1,3]dioxole-4-boronic acid is a versatile compound with significant implications in both synthetic and applied chemistry.

Formula:C₇H₅BF₂O₄

InChI:InChI=1/C7H5BF2O4/c9-7(10)13-5-3-1-2-4(8(11)12)6(5)14-7/h1-3,11-12H

Synonyms:
(2,2-Difluoro-1,3-benzodioxol-4-yl)boronic acid
B-(2,2-Difluoro-1,3-benzodioxol-4-yl)boronic acid
Boronic acid, B-(2,2-difluoro-1,3-benzodioxol-4-yl)-
T56 Bo Do Chj Cf Cf Fbqq [Wln]
2,2-Difluoro-benzo[1,3]dioxole-4-boronic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-(2,2-difluoro-1,3-benzodioxol-4-yl)- REF: IN-DA000RO6CAS: 126120-87-4	98%	To inquire	Thu 27 Mar 25
2,2-Difluoro-1,3-benzodioxole-4-boronic acid REF: 54-PC8515CAS: 126120-87-4	98%	150.00 €~655.00 €	Thu 03 Apr 25
(2,2-Difluorobenzo[d][1,3]dioxol-4-yl)boronic acid REF: 10-F218327CAS: 126120-87-4	95.0%	To inquire	Tue 08 Apr 25
2,2-Difluoro-Benzo[1,3]Dioxole-4-Boronic Acid REF: 3D-FD89184CAS: 126120-87-4	Min. 95%	- - -	Discontinued product