![1-[6-Chloro-2-(methylthio)-4-pyrimidinyl]-4-piperidinecarboxylic acid](https://static.cymitquimica.com/cas-image/67814-1-6-chloro-2-methylthio-4-pyrimidinyl-4-piperidinecarboxylic-acid.png)
CAS 1261231-45-1: 1-[6-Chloro-2-(methylthio)-4-pyrimidinyl]-4-piperidinecarboxylic acid
Description:1-[6-Chloro-2-(methylthio)-4-pyrimidinyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with a chlorine atom and a methylthio group, as well as a piperidine ring with a carboxylic acid functional group. This compound is typically classified as a heterocyclic organic molecule, which often exhibits biological activity due to its structural features. The presence of the chlorine atom and the methylthio group can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The carboxylic acid group contributes to its acidity and potential solubility in polar solvents. Such compounds are often investigated for their pharmacological properties, including potential roles as pharmaceuticals or agrochemicals. The specific properties, such as melting point, solubility, and stability, would depend on the conditions under which the compound is studied. Overall, this compound exemplifies the diverse chemistry found in heterocyclic compounds and their applications in various fields.
Formula:C11H14ClN3O2S
InChI:InChI=1S/C11H14ClN3O2S/c1-18-11-13-8(12)6-9(14-11)15-4-2-7(3-5-15)10(16)17/h6-7H,2-5H2,1H3,(H,16,17)
InChI key:InChIKey=BKYHCPPANKRMRR-UHFFFAOYSA-N
SMILES:O=C(O)C1CCN(C2=NC(=NC(Cl)=C2)SC)CC1
- Synonyms:
- 4-Piperidinecarboxylic acid, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-
- 1-[6-Chloro-2-(methylthio)-4-pyrimidinyl]-4-piperidinecarboxylic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-(6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-piperidine-4-carboxylic acid REF: 10-F090334CAS: 1261231-45-1 | - - - | - - - | Discontinued product |
 | 1-(6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-piperidine-4-carboxylic acid REF: 3D-LAC23145CAS: 1261231-45-1 | Min. 95% | - - - | Discontinued product |
1-(6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-piperidine-4-carboxylic acid
Ref: 10-F090334
| 500mg | Discontinued | Request information |
1-(6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-piperidine-4-carboxylic acid
Ref: 3D-LAC23145
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
