CAS 1261365-40-5: 4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Description:4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dimethoxymethyl substituent contributes to its solubility and reactivity, potentially allowing for various chemical modifications. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing trifluoromethyl group and the electron-donating methoxy groups, which can affect its interaction with biological targets. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atoms, which may also impart unique characteristics in terms of metabolic stability and bioavailability. Overall, this compound represents a fascinating subject for further research in organic synthesis and drug development.
Formula:C11H11F3N2O2
InChI:InChI=1S/C11H11F3N2O2/c1-17-10(18-2)8-6-3-4-15-9(6)16-5-7(8)11(12,13)14/h3-5,10H,1-2H3,(H,15,16)
InChI key:InChIKey=WJIYSKYEYSCWQE-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CN=C2NC=CC2=C1C(OC)OC
- Synonyms:
- 4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-(dimethoxymethyl)-5-(trifluoromethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine REF: IN-DA00HIWBCAS: 1261365-40-5 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine REF: 10-F604810CAS: 1261365-40-5 | 95+% | - - - | Discontinued product |
![]() | 4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine REF: 3D-LAC36540CAS: 1261365-40-5 | Min. 95% | - - - | Discontinued product |

4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Ref: IN-DA00HIWB
Undefined size | To inquire |

4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Ref: 10-F604810
250mg | Discontinued | Request information |

4-(Dimethoxymethyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Ref: 3D-LAC36540
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |