CAS 126165-78-4: 6-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2-(methoxycarbonyl)-5-oxo-6,7-dihydro-1H,5H-pyrazolo[1,2-a]pyrazole-3-carboxylic acid
Description:The chemical substance known as "6-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2-(methoxycarbonyl)-5-oxo-6,7-dihydro-1H,5H-pyrazolo[1,2-a]pyrazole-3-carboxylic acid" with CAS number 126165-78-4 is a complex organic compound characterized by its multi-functional groups and heterocyclic structure. It features a pyrazolo[1,2-a]pyrazole core, which contributes to its potential biological activity. The presence of a thiazole ring and an amino group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The methoxycarbonyl and methoxyimino substituents enhance its solubility and reactivity. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Its intricate structure indicates potential for diverse applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many complex organic compounds, careful consideration of its synthesis, stability, and reactivity is essential for practical applications.
Formula:C15H16N6O7S
InChI:InChI=1/C15H16N6O7S/c1-27-14(26)6-3-20-4-7(12(23)21(20)10(6)13(24)25)17-11(22)9(19-28-2)8-5-29-15(16)18-8/h5,7H,3-4H2,1-2H3,(H2,16,18)(H,17,22)(H,24,25)/b19-9+
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | LY 173013 REF: TM-T27882CAS: 126165-78-4 | 98% | 1,094.00 €~2,945.00 € | Thu 29 May 25 |

LY 173013
Ref: TM-T27882
25mg | 1,730.00 € | ||
50mg | 2,262.00 € | ||
100mg | 2,945.00 € |