![3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid](https://static.cymitquimica.com/cas-image/168814-3-methyl-5-nitro-11-biphenyl-3-carboxylic-acid.png)
CAS 1261953-03-0: 3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid
Description:3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 3′ position and a nitro group at the 5 position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carboxylic acid functional group at the 3 position enhances its acidity and solubility in polar solvents. This compound may exhibit various reactivity patterns typical of substituted aromatic compounds, including electrophilic aromatic substitution and nucleophilic reactions due to the electron-withdrawing nature of the nitro group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent environment. As with many nitro-substituted compounds, it may also exhibit distinct spectroscopic characteristics, making it identifiable through techniques like NMR and IR spectroscopy.
Formula:C14H11NO4
InChI:InChI=1S/C14H11NO4/c1-9-3-2-4-10(5-9)11-6-12(14(16)17)8-13(7-11)15(18)19/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=FRYFCZOBPJEQJY-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C=C(C1)N(=O)=O)C=2C=CC=C(C2)C
- Synonyms:
- 3′-Methyl-5-nitro[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-methyl-5-nitro-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | [1,1'-Biphenyl]-3-carboxylic acid, 3'-methyl-5-nitro- REF: IN-DA000S8XCAS: 1261953-03-0 | - - - | To inquire | Thu 27 Mar 25 |
 | 3'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid REF: 10-F212197CAS: 1261953-03-0 | 95.0% | - - - | Discontinued product |
 | 3-(3-Methylphenyl)-5-nitrobenzoic acid REF: 3D-LAC95303CAS: 1261953-03-0 | Min. 95% | - - - | Discontinued product |
![[1,1'-Biphenyl]-3-carboxylic acid, 3'-methyl-5-nitro-](https://static.cymitquimica.com/products/IN/thumb/DA000S8X.jpg)
[1,1'-Biphenyl]-3-carboxylic acid, 3'-methyl-5-nitro-
Ref: IN-DA000S8X
| Undefined size | To inquire |
![3'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid](https://static.cymitquimica.com/products/10/thumb/F212197.jpg)
3'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid
Ref: 10-F212197
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
3-(3-Methylphenyl)-5-nitrobenzoic acid
Ref: 3D-LAC95303
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
