CAS 1263365-88-3: 2-(1,3-Dioxolan-2-yl)-1-(4-iodophenyl)ethanone

Description: 2-(1,3-Dioxolan-2-yl)-1-(4-iodophenyl)ethanone is an organic compound characterized by its unique structural features, which include a dioxolane ring and an iodophenyl group. The presence of the dioxolane moiety suggests that the compound may exhibit properties typical of cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The iodophenyl group introduces significant electronic effects due to the electronegative iodine atom, which can influence the compound's reactivity and polarity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Additionally, the presence of both a ketone functional group and a heterocyclic ring may provide opportunities for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, the combination of these structural elements contributes to the compound's unique chemical behavior and potential applications.

Formula: C₁₁H₁₁IO₃

InChI: InChI=1S/C11H11IO3/c12-9-3-1-8(2-4-9)10(13)7-11-14-5-6-15-11/h1-4,11H,5-7H2

InChI key: InChIKey=UCTZBEKWABWPDU-UHFFFAOYSA-N

SMILES: O=C(C1=CC=C(I)C=C1)CC2OCCO2

Synonyms:

• Ethanone, 2-(1,3-dioxolan-2-yl)-1-(4-iodophenyl)-
• 2-(1,3-Dioxolan-2-yl)-1-(4-iodophenyl)ethanone

2-(1,3-Dioxolan-2-yl)-1-(4-iodo-phenyl)-ethanone

CAS: 1263365-88-3

• Purity: 97.0%
• Molecular weight: 318.1099853515625

2-(1,3-Dioxolan-2-yl)-1-(4-iodo-phenyl)-ethanone

CAS: 1263365-88-3

Versatile small molecule scaffold

• Formula: C₁₁H₁₁IO₃
• Purity: Min. 95%
• Molecular weight: 318.11 g/mol