CAS 1263378-30-8: Tetrahydro-3-methyl-2H-pyran-4-amine

Description:Tetrahydro-3-methyl-2H-pyran-4-amine is a chemical compound characterized by its cyclic structure, which includes a pyran ring—a six-membered ring containing one oxygen atom and five carbon atoms. The presence of an amine functional group indicates that it contains a nitrogen atom bonded to hydrogen atoms or carbon chains, contributing to its reactivity and potential as a building block in organic synthesis. The "tetrahydro" prefix denotes that the compound is fully saturated, meaning it does not contain double bonds, which influences its stability and reactivity. The methyl group attached to the pyran ring can affect the compound's physical properties, such as boiling point and solubility, as well as its biological activity. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which can interact with biological targets. However, specific applications and biological effects would require further investigation and research.

Formula:C₆H₁₃NO

InChI:InChI=1S/C6H13NO/c1-5-4-8-3-2-6(5)7/h5-6H,2-4,7H2,1H3

InChI key:InChIKey=WFVKNHIDEGYGPD-UHFFFAOYSA-N

SMILES:O1CCC(N)C(C)C1

Synonyms:
2H-Pyran-4-amine, tetrahydro-3-methyl-
Tetrahydro-3-methyl-2H-pyran-4-amine
3-Methyloxan-4-amine
3-Methyltetrahydropyran-4-amine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2H-Pyran-4-amine, tetrahydro-3-methyl- REF: IN-DA000SOPCAS: 1263378-30-8	- - -	To inquire	Thu 27 Mar 25
3-Methyltetrahydro-2H-pyran-4-amine REF: 10-F385279CAS: 1263378-30-8	95.0%	To inquire	Tue 08 Apr 25
3-Methyloxan-4-amine REF: 3D-NAC37830CAS: 1263378-30-8	Min. 95%	- - -	Discontinued product