
CAS 1263378-87-5: Ethanone, 1-(3-amino-2-pyridinyl)-, hydrochloride (1:1)
Description:Ethanone, 1-(3-amino-2-pyridinyl)-, hydrochloride (1:1), with the CAS number 1263378-87-5, is a chemical compound characterized by its pyridine ring structure, which contributes to its biological activity. This substance features an ethanone moiety linked to a 3-amino-2-pyridinyl group, indicating the presence of both ketone and amine functional groups. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Its hydrochloride form may also influence its stability and bioavailability. Overall, this compound is likely to exhibit properties typical of both ketones and amines, including reactivity in nucleophilic substitution reactions and potential for forming coordination complexes with metal ions. Further studies would be necessary to elucidate its specific pharmacological effects and applications.
Formula:C7H8N2O·ClH
InChI:InChI=1S/C7H8N2O.ClH/c1-5(10)7-6(8)3-2-4-9-7;/h2-4H,8H2,1H3;1H
InChI key:InChIKey=INJHORIMRTUTAF-UHFFFAOYSA-N
SMILES:Cl.O=C(C1=NC=CC=C1N)C
- Synonyms:
- Ethanone, 1-(3-amino-2-pyridinyl)-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(3-Aminopyridin-2-yl)ethan-1-one hydrochloride REF: 10-F728070CAS: 1263378-87-5 | 97% | - - - | Discontinued product |
![]() | 1-(3-Amino-pyridin-2-yl)-ethanone hydrochloride REF: 3D-NAC37887CAS: 1263378-87-5 | Min. 95% | - - - | Discontinued product |

1-(3-Aminopyridin-2-yl)ethan-1-one hydrochloride
Ref: 10-F728070
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

1-(3-Amino-pyridin-2-yl)-ethanone hydrochloride
Ref: 3D-NAC37887
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |