
CAS 1266376-74-2: 3-(3-Chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid
Description:3-(3-Chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The compound features a chloro substituent and a methoxy group on the phenyl ring, which can influence its reactivity and solubility. The chloro group may enhance the compound's biological activity by modulating interactions with biological targets, while the methoxy group can affect its electronic properties. This compound may be of interest in pharmaceutical research due to its potential biological activities, including anti-inflammatory or analgesic properties. Its structural characteristics suggest it could be involved in various synthetic pathways, making it a valuable intermediate in organic synthesis. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.
Formula:C11H9ClN2O3
InChI:InChI=1S/C11H9ClN2O3/c1-17-9-3-2-6(4-8(9)12)10-7(11(15)16)5-13-14-10/h2-5H,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=ARJWVVAGGJKBHN-UHFFFAOYSA-N
SMILES:O=C(O)C1=CNN=C1C=2C=CC(OC)=C(Cl)C2
- Synonyms:
- 1H-Pyrazole-4-carboxylic acid, 3-(3-chloro-4-methoxyphenyl)-
- 3-(3-Chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(3-Chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid REF: 10-F721329CAS: 1266376-74-2 | 98% | - - - | Discontinued product |

3-(3-Chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid
Ref: 10-F721329
50mg | Discontinued | Request information |