CAS 127024-32-2: β-Amino-3-furanpropanoic acid

Description:β-Amino-3-furanpropanoic acid is an organic compound characterized by the presence of both an amino group and a furan ring within its structure. This compound features a propanoic acid backbone, which contributes to its acidic properties. The furan ring, a five-membered aromatic heterocycle containing oxygen, imparts unique reactivity and stability to the molecule. β-Amino-3-furanpropanoic acid is typically classified as an amino acid derivative, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to mimic natural amino acids. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a building block for peptide synthesis. Its solubility and stability in various solvents can vary, which is important for its application in biological systems. As with many amino acids and their derivatives, the stereochemistry of β-Amino-3-furanpropanoic acid can play a significant role in its biological interactions and efficacy.

Formula:C₇H₉NO₃

InChI:InChI=1S/C7H9NO3/c8-6(3-7(9)10)5-1-2-11-4-5/h1-2,4,6H,3,8H2,(H,9,10)

InChI key:InChIKey=DWJKCGVVFLNGRV-UHFFFAOYSA-N

SMILES:O=C(O)CC(N)C1=COC=C1

Synonyms:
(RS)-3-Amino-3-(3-furyl)propanoic acid
3-Furanpropanoic acid, β-amino-
β-Amino-3-furanpropanoic acid
3-Amino-3-furan-3-yl-propionic acid
3-Amino-3-(furan-3-yl)propanoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3-Furanpropanoic acid, β-amino- REF: IN-DA000WK2CAS: 127024-32-2	- - -	To inquire	Thu 27 Mar 25
3-Amino-3-(furan-3-yl)propanoic acid REF: 10-F680151CAS: 127024-32-2	97%	To inquire	Tue 08 Apr 25
3-Amino-3-furan-3-yl-propionic acid REF: 3D-CFA02432CAS: 127024-32-2	Min. 95%	- - -	Discontinued product