CAS 127074-39-9: 2-nitro-N-(2-nitrophenyl)-N-phenyl-aniline
Description:2-Nitro-N-(2-nitrophenyl)-N-phenyl-aniline, with the CAS number 127074-39-9, is an organic compound characterized by its complex structure, which includes an aniline moiety substituted with nitro groups. This compound typically exhibits a yellow to orange color due to the presence of nitro groups, which can also influence its electronic properties and reactivity. It is likely to be a solid at room temperature and may have moderate solubility in organic solvents. The presence of multiple nitro groups suggests that it may have applications in dye chemistry or as an intermediate in the synthesis of other organic compounds. Additionally, the compound may exhibit interesting optical properties and could be studied for its potential use in materials science or as a reagent in various chemical reactions. However, due to the presence of nitro groups, it may also pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C18H13N3O4
InChI:InChI=1/C18H13N3O4/c22-20(23)17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)21(24)25/h1-13H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzenamine, 2-nitro-N-(2-nitrophenyl)-N-phenyl- REF: IN-DA000WNJCAS: 127074-39-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | Bis-(2-nitrophenyl)phenylamine REF: 3D-FB18680CAS: 127074-39-9 | Min. 95% | - - - | Discontinued product |

Benzenamine, 2-nitro-N-(2-nitrophenyl)-N-phenyl-
Ref: IN-DA000WNJ
Undefined size | To inquire |

Bis-(2-nitrophenyl)phenylamine
Ref: 3D-FB18680
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |