CAS 127310-66-1: (1-benzylazetidine-2,4-diyl)dimethanol

Description:(1-benzylazetidine-2,4-diyl)dimethanol, identified by its CAS number 127310-66-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The presence of the benzyl group indicates that there is a phenyl ring attached to the nitrogen atom of the azetidine, contributing to its aromatic properties. The compound features two hydroxymethyl (-CH2OH) groups, which enhance its potential for hydrogen bonding and solubility in polar solvents. This structure suggests that it may exhibit interesting biological activity, potentially serving as a scaffold for drug development. The presence of both the azetidine and benzyl functionalities may influence its reactivity and interaction with biological targets. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula:C₁₂H₁₇NO₂

InChI:InChI=1/C12H17NO2/c14-8-11-6-12(9-15)13(11)7-10-4-2-1-3-5-10/h1-5,11-12,14-15H,6-9H2

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,4-Azetidinedimethanol, 1-(phenylmethyl)-, (2R,4S)-rel- REF: IN-DA000WXDCAS: 127310-66-1	95%	32.00 €~523.00 €	Thu 27 Mar 25
(1-Benzylazetidine-2,4-diyl)dimethanol REF: 54-OR309011CAS: 127310-66-1	97%	124.00 €~481.00 €	Fri 28 Mar 25
Cis-(1-Benzylazetidine-2,4-diyl)dimethanol REF: 10-F436339CAS: 127310-66-1	95.0%	To inquire	Tue 08 Apr 25
(1-Benzylazetidine-2,4-diyl)dimethanol REF: 3D-CFA31066CAS: 127310-66-1	Min. 95%	- - -	Discontinued product