CAS 128073-33-6: 2,2-Difluoro-1-methylcyclopropanecarboxylic acid
Description:2,2-Difluoro-1-methylcyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which features a carboxylic acid functional group and two fluorine atoms attached to the second carbon of the cyclopropane ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of fluorine atoms enhances its reactivity and polarity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. Additionally, the methyl group attached to the cyclopropane ring can affect the compound's steric properties and overall reactivity. Due to its specific structure, 2,2-Difluoro-1-methylcyclopropanecarboxylic acid may exhibit interesting biological activities, although detailed studies on its toxicity and environmental impact are necessary for comprehensive understanding.
Formula:C5H6F2O2
InChI:InChI=1S/C5H6F2O2/c1-4(3(8)9)2-5(4,6)7/h2H2,1H3,(H,8,9)
InChI key:InChIKey=HLFLYOQLHYYNLT-UHFFFAOYSA-N
SMILES:O=C(O)C1(C)CC1(F)F
- Synonyms:
- 2,2-Difluoro-1-methyl-1-cyclopropanecarboxylic acid
- 2,2-Difluoro-1-methylcyclopropane-1-carboxylic acid
- 2,2-Difluoro-1-methylcyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 2,2-difluoro-1-methyl-

(±)-2,2-Difluoro-1-methylcyclopropanecarboxylic acid, 97%
Ref: 02-H33055
1g | To inquire | ||
250mg | To inquire |

Cyclopropanecarboxylic acid, 2,2-difluoro-1-methyl-
Ref: IN-DA000XR1
1g | 114.00 € | ||
5g | 506.00 € | ||
10g | To inquire | ||
25g | To inquire | ||
100mg | 58.00 € | ||
250mg | 68.00 € | ||
500mg | 101.00 € |

(+/-)-2,2-Difluoro-1-methylcyclopropanecarboxylic acid
Ref: 54-PC520853
1g | 147.00 € | ||
5g | 566.00 € | ||
25g | 2,561.00 € | ||
100mg | 53.00 € | ||
250mg | 65.00 € |

2,2-Difluoro-1-methylcyclopropanecarboxylic acid
Ref: 10-F217705
1g | 123.00 € | ||
5g | 474.00 € | ||
10g | 852.00 € | ||
25g | 1,894.00 € | ||
50g | To inquire | ||
100mg | 50.00 € | ||
250mg | 67.00 € | ||
500mg | 92.00 € |

2,2-Difluoro-1-Methylcyclopropanecarboxylic Acid
Ref: 3D-FD91006
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |