CAS 1283108-45-1: 1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid

Description: 1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an azetidine ring. The presence of the methyl group on the benzothiazole contributes to its hydrophobic characteristics, while the carboxylic acid functional group enhances its polarity and solubility in polar solvents. This compound may exhibit biological activity due to its structural components, potentially interacting with various biological targets. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interactions in chemical processes. Additionally, the azetidine ring may impart strain, affecting the compound's stability and reactivity. The compound's specific applications and behavior in various environments would depend on its physicochemical properties, such as melting point, boiling point, and solubility, which are essential for understanding its potential uses in pharmaceuticals or agrochemicals. Overall, 1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₂H₁₂N₂O₂S

InChI: InChI=1S/C12H12N2O2S/c1-7-3-2-4-9-10(7)13-12(17-9)14-5-8(6-14)11(15)16/h2-4,8H,5-6H2,1H3,(H,15,16)

InChI key: InChIKey=IOYFANQCZHJMFV-UHFFFAOYSA-N

SMILES: O=C(O)C1CN(C2=NC=3C(S2)=CC=CC3C)C1

1-(4-Methylbenzo[d]thiazol-2-yl)azetidine-3-carboxylic acid

CAS: 1283108-45-1

• Purity: 98%
• Molecular weight: 248.3000030517578

1-(4-Methyl-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid

CAS: 1283108-45-1

Please enquire for more information about 1-(4-Methyl-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid including the price, delivery time and more …

• Formula: C₁₂H₁₂N₂O₂S
• Purity: Min. 95%
• Molecular weight: 248.3 g/mol