CAS 1283108-96-2: 1-(4-Methoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid

Description: 1-(4-Methoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an azetidine ring. The presence of the methoxy group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxylic acid functional group and the ability to participate in hydrogen bonding. The benzothiazole component may contribute to its electronic properties, possibly affecting its reactivity and interaction with biological targets. Given its structural complexity, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it could serve as a lead compound or a building block for further synthesis. However, specific biological activities, toxicity, and pharmacokinetic properties would require empirical investigation to fully understand its potential uses and safety profile.

Formula: C₁₂H₁₂N₂O₃S

InChI: InChI=1S/C12H12N2O3S/c1-17-8-3-2-4-9-10(8)13-12(18-9)14-5-7(6-14)11(15)16/h2-4,7H,5-6H2,1H3,(H,15,16)

InChI key: InChIKey=FAINHLDDTNFABM-UHFFFAOYSA-N

SMILES: O=C(O)C1CN(C2=NC=3C(OC)=CC=CC3S2)C1

1-(4-methoxy-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid

CAS: 1283108-96-2

• Purity: 95.0%
• Molecular weight: 264.29998779296875

1-(4-Methoxy-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid

CAS: 1283108-96-2

Versatile small molecule scaffold

• Formula: C₁₂H₁₂N₂O₃S
• Purity: Min. 95%
• Molecular weight: 264.3 g/mol