CAS 1286776-46-2: 5-Fluoro-α-(trifluoromethyl)-2-pyridinemethanol

Description:5-Fluoro-α-(trifluoromethyl)-2-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a trifluoromethyl group at the α-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxymethyl group (-CH2OH) at the 2-position enhances its reactivity, making it a candidate for various chemical transformations. This compound may exhibit interesting pharmacological properties due to its structural features, which can influence interactions with biological targets. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioavailability in drug design. Overall, 5-Fluoro-α-(trifluoromethyl)-2-pyridinemethanol is of interest in medicinal chemistry and may have applications in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance.

Formula:C₇H₅F₄NO

InChI:InChI=1S/C7H5F4NO/c8-4-1-2-5(12-3-4)6(13)7(9,10)11/h1-3,6,13H

InChI key:InChIKey=ZWUQASWPDGMMIS-UHFFFAOYSA-N

SMILES:FC1=CN=C(C=C1)C(O)C(F)(F)F