CAS 128740-02-3: Ethyl N-(2,2-dimethoxyethyl)-N-2-propen-1-ylcarbamate
Description:Ethyl N-(2,2-dimethoxyethyl)-N-2-propen-1-ylcarbamate, identified by its CAS number 128740-02-3, is an organic compound characterized by its carbamate functional group. This substance features a unique structure that includes an ethyl group, a propenyl moiety, and two methoxy groups attached to a carbon chain. The presence of the carbamate functional group suggests potential applications in agrochemicals, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The dimethoxyethyl substituent may enhance its solubility and stability in various solvents, making it suitable for formulation in agricultural products. Additionally, the propenyl group can participate in further chemical reactions, potentially allowing for the synthesis of more complex molecules. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would be influenced by its molecular structure and the presence of functional groups. Safety and handling considerations are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-5-7-11(10(12)15-6-2)8-9(13-3)14-4/h5,9H,1,6-8H2,2-4H3
InChI key:InChIKey=SXIOXBYMPVICFV-UHFFFAOYSA-N
SMILES:O=C(OCC)N(CC=C)CC(OC)OC
- Synonyms:
- Carbamic acid, (2,2-dimethoxyethyl)-2-propenyl-, ethyl ester
- Carbamic acid, N-(2,2-dimethoxyethyl)-N-2-propen-1-yl-, ethyl ester
- Ethyl N-(2,2-dimethoxyethyl)-N-2-propen-1-ylcarbamate
- Ethyl allyl(2,2-dimethoxyethyl)carbamate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | ETHYL ALLYL2,2-DIMETHOXYETHYLCARBAMATE REF: IN-DA00AFSUCAS: 128740-02-3 | - - - | To inquire | Thu 27 Mar 25 |
 | ETHYL ALLYL 2,2-DIMETHOXYETHYLCARBAMATE REF: 10-F334122CAS: 128740-02-3 | 95.0% | To inquire | Tue 08 Apr 25 |
 | Ethyl allyl 2,2-dimethoxyethylcarbamate REF: 3D-DFA74002CAS: 128740-02-3 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA00AFSU
| Undefined size | To inquire |
ETHYL ALLYL 2,2-DIMETHOXYETHYLCARBAMATE
Ref: 10-F334122
| 1g | To inquire |
Ethyl allyl 2,2-dimethoxyethylcarbamate
Ref: 3D-DFA74002
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
