CAS 129280-33-7: Semilicoisoflavone B
Description:Semilicoisoflavone B, with the CAS number 129280-33-7, is a chemical compound classified as an isoflavonoid, which is a type of flavonoid commonly found in various plants. Isoflavonoids are known for their potential health benefits, including antioxidant, anti-inflammatory, and estrogenic activities. Semilicoisoflavone B exhibits a unique structure that contributes to its biological properties, often influencing its interaction with biological systems. This compound is typically studied for its role in traditional medicine and its potential applications in pharmacology. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. Research into Semilicoisoflavone B may focus on its extraction from natural sources, synthesis, and evaluation of its pharmacological effects, particularly in relation to cancer and hormonal health. As with many natural products, understanding its mechanism of action and potential therapeutic uses remains an area of active investigation in the field of medicinal chemistry.
Formula:C20H16O6
InChI:InChI=1S/C20H16O6/c1-20(2)4-3-10-5-11(6-15(23)19(10)26-20)13-9-25-16-8-12(21)7-14(22)17(16)18(13)24/h3-9,21-23H,1-2H3
InChI key:InChIKey=LWZACZCRAUQSLH-UHFFFAOYSA-N
SMILES:O=C1C(=COC=2C=C(O)C=C(O)C12)C=3C=C(O)C=4OC(C=CC4C3)(C)C
- Synonyms:
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(8-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-
- 5,7-Dihydroxy-3-(8-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-4H-1-benzopyran-4-one
- Semilicoisoflavone B
4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(8-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-
Ref: IN-DA000Z1P
| 5mg | 497.00 € |
Semilicoisoflavone B
Ref: TM-TN2201
| 2mg | 525.00 € | ||
| 5mg | 1,008.00 € | ||
| 10mg | 1,833.00 € |
Ref: BP-SBP03403
| Undefined size | To inquire |
Semilicoisoflavone B
Ref: 3D-EFA28033
| 10mg | 1,028.00 € | ||
| 25mg | 1,676.00 € | ||
| 50mg | 2,681.00 € |
