CAS 129536-41-0: Bisbisbenzyloxybenzyloxybenzylbromide
Description:Bisbisbenzyloxybenzyloxybenzylbromide, identified by its CAS number 129536-41-0, is a synthetic organic compound characterized by its complex structure, which includes multiple benzyl and ether functionalities. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for undergoing electrophilic substitution reactions. The presence of bromine in its structure suggests it may participate in nucleophilic substitution reactions, making it useful in various organic synthesis applications. Additionally, the multiple benzyl ether groups can enhance solubility in organic solvents and may influence its reactivity and interaction with biological systems. Due to its intricate structure, it may also exhibit interesting optical properties, potentially making it valuable in materials science or as a precursor in the synthesis of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C49H43BrO6
InChI:InChI=1/C49H43BrO6/c50-30-41-21-44(55-35-42-23-46(51-31-37-13-5-1-6-14-37)28-47(24-42)52-32-38-15-7-2-8-16-38)27-45(22-41)56-36-43-25-48(53-33-39-17-9-3-10-18-39)29-49(26-43)54-34-40-19-11-4-12-20-40/h1-29H,30-36H2
- Synonyms:
- 3,5-Bis[3,5-bis(benzyloxy)benzyloxy]benzyl bromide
- 1,1'-{[5-(Bromomethyl)Benzene-1,3-Diyl]Bis(Oxymethanediyl)}Bis[3,5-Bis(Benzyloxy)Benzene]
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzene, 1,3-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-5-(bromomethyl)- REF: IN-DA000Z71CAS: 129536-41-0 | >97.0%(HPLC) | To inquire | Thu 27 Mar 25 |
![]() | 3,5-Bis[3,5-bis(benzyloxy)benzyloxy]benzyl Bromide REF: 3B-B2118CAS: 129536-41-0 | >97.0%(HPLC) | 213.00 €~802.00 € | Tue 01 Apr 25 |
![]() | 3,5-Bis[3,5-bis(benzyloxy)benzyloxy]benzyl Bromide REF: 3D-FB61752CAS: 129536-41-0 | Min. 95% | - - - | Discontinued product |

Benzene, 1,3-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-5-(bromomethyl)-
Ref: IN-DA000Z71
Undefined size | To inquire |

3,5-Bis[3,5-bis(benzyloxy)benzyloxy]benzyl Bromide
Ref: 3B-B2118
1g | 213.00 € | ||
5g | 802.00 € |

3,5-Bis[3,5-bis(benzyloxy)benzyloxy]benzyl Bromide
Ref: 3D-FB61752
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |