CAS 129540-24-5: 2-(2-Bromophenyl)pyrrolidine

Description:2-(2-Bromophenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a bromophenyl group at the 2-position of the pyrrolidine ring imparts specific chemical properties, including increased lipophilicity and potential for various interactions in biological systems. This compound typically exhibits a moderate to high boiling point due to its molecular structure and the presence of the bromine atom, which can influence its reactivity and stability. It may participate in nucleophilic substitution reactions due to the presence of the bromine atom, which can act as a leaving group. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolidine moiety is often found in biologically active compounds. Its solubility characteristics can vary depending on the solvent, and it may exhibit specific optical activity if chiral centers are present. Overall, 2-(2-Bromophenyl)pyrrolidine is a compound of interest for further research in organic synthesis and pharmacology.

Formula:C₁₀H₁₂BrN

InChI:InChI=1S/C10H12BrN/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-2,4-5,10,12H,3,6-7H2

InChI key:InChIKey=BSLGMIVYENBFFY-UHFFFAOYSA-N

SMILES:BrC=1C=CC=CC1C2NCCC2

Synonyms:
2-(4-Ethoxyphenyl)Pyrrolidine
Pyrrolidine, 2-(2-Bromophenyl)-
2-(2-Bromophenyl)pyrrolidine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Pyrrolidine, 2-(2-bromophenyl)- REF: IN-DA000Z6WCAS: 129540-24-5	97%	To inquire	Thu 27 Mar 25
2-(2-Bromophenyl)pyrrolidine REF: 54-OR93990CAS: 129540-24-5	95%	148.00 €~1,633.00 €	Fri 28 Mar 25
2-(2-Bromophenyl)pyrrolidine REF: 10-F077330CAS: 129540-24-5	95.0%	61.00 €~886.00 €	Tue 01 Apr 25
2-(2-Bromophenyl)pyrrolidine REF: 3D-FB43555CAS: 129540-24-5	Min. 95%	- - -	Discontinued product