CAS 129639-79-8: Abafungin
Description:Abafungin is a chemical compound classified as a fungicide, primarily used in agricultural applications to control fungal diseases in crops. It belongs to the class of compounds known as triazoles, which are characterized by a five-membered ring containing three nitrogen atoms. Abafungin exhibits broad-spectrum antifungal activity, making it effective against various plant pathogens. Its mode of action typically involves the inhibition of ergosterol biosynthesis, a crucial component of fungal cell membranes, thereby disrupting fungal growth and reproduction. The compound is generally applied as a foliar spray or soil treatment, depending on the target crop and disease. In terms of physical properties, Abafungin is typically a solid at room temperature, with specific solubility characteristics that influence its application and efficacy. Safety and environmental impact assessments are essential for its use, as with any pesticide, to ensure minimal adverse effects on non-target organisms and ecosystems. Overall, Abafungin plays a significant role in integrated pest management strategies in agriculture.
Formula:C21H22N4OS
InChI:InChI=1S/C21H22N4OS/c1-14-8-9-18(15(2)12-14)26-19-7-4-3-6-16(19)17-13-27-21(24-17)25-20-22-10-5-11-23-20/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H2,22,23,24,25)
InChI key:InChIKey=TYBHXIFFPVFXQW-UHFFFAOYSA-N
SMILES:N1=C(SC=C1C=2C=CC=CC2OC3=CC=C(C=C3C)C)NC4=NCCCN4
- Synonyms:
- 2-Pyrimidinamine, N-[4-[2-(2,4-dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro-
- Abafungin [INN:BAN]
- Bay-W 6341
- Hexahydro-2-((4-(o-(2,4-xylyloxy)phenyl)-2-thiazolyl)imino)pyrimidine
- N-[4-[2-(2,4-Dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro-2-pyrimidinamine
- N-{4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl}-1,4,5,6-tetrahydropyrimidin-2-amine
- Unii-11Di31Lwxf
- Abafungin
- Abafungin
![2-Pyrimidinamine, N-[4-[2-(2,4-dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro-](https://static.cymitquimica.com/products/IN/thumb/DA000Z9B.jpg)
