CAS 1297613-76-3: Diindeno[7,1-de:1′,7′-fg][1,3,2]dioxaphosphocin, 3,7-bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydroxy-, 5-oxide, (11aR)-
Description:Diindeno[7,1-de:1′,7′-fg][1,3,2]dioxaphosphocin, with the CAS number 1297613-76-3, is a complex organic compound characterized by its unique polycyclic structure that incorporates both dioxaphosphocin and multiple aromatic rings. This compound features a phosphorous atom integrated into a cyclic framework, which contributes to its potential reactivity and stability. The presence of trifluoromethyl groups on the phenyl rings enhances its lipophilicity and may influence its electronic properties, making it of interest in various chemical applications. The compound is likely to exhibit interesting optical and electronic characteristics due to its conjugated system. Additionally, the hydroxyl group suggests potential for hydrogen bonding and reactivity in various chemical environments. Its stereochemistry, indicated by the (11aR) designation, may also play a crucial role in its biological activity and interactions. Overall, this compound's intricate structure and functional groups position it as a candidate for further research in fields such as materials science, medicinal chemistry, and organic synthesis.
Formula:C33H19F12O4P
InChI:InChI=1S/C33H19F12O4P/c34-30(35,36)19-9-17(10-20(13-19)31(37,38)39)23-3-1-15-5-7-29-8-6-16-2-4-24(28(26(16)29)49-50(46,47)48-27(23)25(15)29)18-11-21(32(40,41)42)14-22(12-18)33(43,44)45/h1-4,9-14H,5-8H2,(H,46,47)
InChI key:InChIKey=SZXXNKRVJAEGKW-UHFFFAOYSA-N
SMILES:O=P1(O)OC=2C(=CC=C3C2C4(C5=C(O1)C(=CC=C5CC4)C=6C=C(C=C(C6)C(F)(F)F)C(F)(F)F)CC3)C=7C=C(C=C(C7)C(F)(F)F)C(F)(F)F
- Synonyms:
- Diindeno[7,1-de:1′,7′-fg][1,3,2]dioxaphosphocin, 3,7-bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydroxy-, 5-oxide, (11aR)-

(11aR)-3,7-Bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydroxy-5-oxide-diindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin, min. 98%
Ref: 08-15-0527
25mg | 312.00 € | ||
100mg | 1,016.00 € |

Diindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin, 3,7-bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydroxy-, 5-oxide, (11aR)-
Ref: IN-DA000TNE
1g | To inquire | ||
50mg | 187.00 € | ||
100mg | 230.00 € | ||
250mg | 613.00 € |

(11aR)-3,7-Bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydroxy-5-oxide-diindeno[7,1-de:1',7'-fg][1,3,2]dioxaphospho cin
Ref: 3D-FB103792
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |