CAS 1299607-83-2: 2,4-Dibromo-6-chloro-3-pyridinamine

Description: 2,4-Dibromo-6-chloro-3-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two bromine atoms at the 2 and 4 positions, along with a chlorine atom at the 6 position, contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The amino group (-NH2) at the 3 position enhances its solubility in polar solvents and may influence its biological activity. This compound is likely to exhibit properties typical of halogenated pyridines, such as increased lipophilicity and potential for electrophilic substitution reactions. Additionally, the presence of multiple halogens can affect its stability and reactivity, making it a subject of interest for further research in synthetic chemistry and material science. Safety data and handling precautions should be considered due to the presence of halogens, which can pose environmental and health risks.

Formula: C₅H₃Br₂ClN₂

InChI: InChI=1S/C5H3Br2ClN2/c6-2-1-3(8)10-5(7)4(2)9/h1H,9H2

InChI key: InChIKey=LXCKKZBYYPOUDA-UHFFFAOYSA-N

SMILES: ClC=1N=C(Br)C(N)=C(Br)C1

Synonyms:

• 3-Pyridinamine, 2,4-dibromo-6-chloro-
• 2,4-Dibromo-6-chloro-3-pyridinamine

3-Pyridinamine, 2,4-dibromo-6-chloro-

CAS: 1299607-83-2

• Formula: C₅H₃Br₂ClN₂
• Molecular weight: 286.3517

2,4-Dibromo-6-chloropyridin-3-amine

CAS: 1299607-83-2

• Purity: 95+%
• Molecular weight: 286.3500061035156

2,4-Dibromo-6-chloropyridin-3-amine

CAS: 1299607-83-2

Versatile small molecule scaffold

• Formula: C₅H₃Br₂ClN₂
• Purity: Min. 95%
• Molecular weight: 286.35 g/mol