CAS 1303968-08-2: Cyclohexanecarbonitrile, 4-amino-, hydrochloride (1:1)

Description:Cyclohexanecarbonitrile, 4-amino-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure and the presence of both a nitrile and an amino functional group. The compound features a cyclohexane ring substituted with a carbonitrile group and an amino group at the para position, which contributes to its reactivity and potential applications in organic synthesis and pharmaceuticals. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, making it suitable for various chemical reactions. The presence of the amino group allows for hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.

Formula:C₇H₁₂N₂·ClH

InChI:InChI=1S/C7H12N2.ClH/c8-5-6-1-3-7(9)4-2-6;/h6-7H,1-4,9H2;1H

InChI key:InChIKey=BTLVSLNZSMIPCW-UHFFFAOYSA-N

SMILES:Cl.N#CC1CCC(N)CC1

Synonyms:
4-Aminocyclohexanecarbonitrile hydrochloride
Cyclohexanecarbonitrile, 4-amino-, hydrochloride (1:1)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Aminocyclohexanecarbonitrile hydrochloride REF: IN-DA003AOQCAS: 1303968-08-2	97%	To inquire	Thu 27 Mar 25
4-Aminocyclohexanecarbonitrile hydrochloride REF: 10-F464714CAS: 1303968-08-2	95.0%	67.00 €~180.00 €	Tue 01 Apr 25
4-Aminocyclohexanecarbonitrile hydrochloride REF: 54-OR500002CAS: 1303968-08-2	97%	41.00 €~824.00 €	Thu 03 Apr 25
4-Amino-cyclohexanecarbonitrile hydrochloride REF: 3D-DCC96808CAS: 1303968-08-2	Min. 95%	- - -	Discontinued product