CAS 130406-30-3: N-FMOC-D-phenylalaninol
Description:N-FMOC-D-phenylalaninol is a chemical compound characterized by its structure, which includes a phenylalanine derivative with a fluorenylmethyloxycarbonyl (FMOC) protecting group. This compound is primarily used in peptide synthesis, particularly in the solid-phase synthesis of peptides, where it serves as a protective group for the amino group of phenylalanine. The FMOC group is known for its stability under basic conditions and can be easily removed under mild acidic conditions, making it advantageous for sequential peptide synthesis. N-FMOC-D-phenylalaninol is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethylformamide. Its molecular structure contributes to its role in facilitating the formation of peptide bonds while protecting the amino functionality during synthesis. Additionally, the presence of the D-configuration of phenylalanine can influence the stereochemistry and biological activity of the resulting peptides. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C24H23NO3
InChI:InChI=1/C24H23NO3/c26-15-18(14-17-8-2-1-3-9-17)25-24(27)28-16-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,18,23,26H,14-16H2,(H,25,27)/t18-/m1/s1
- Synonyms:
- 9H-fluoren-9-ylmethyl [(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate
- Fmoc-D-Phenylalaninol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2-phenylethyl]-, 9H-fluoren-9-ylmethyl ester REF: IN-DA000UDFCAS: 130406-30-3 | 98% | 54.00 €~227.00 € | Wed 12 Mar 25 |
![]() | Fmoc-d-Phenylalaninol REF: 10-F046653CAS: 130406-30-3 | 95.0% | To inquire | Mon 24 Mar 25 |
![]() | Fmoc-D-Phenylalaninol REF: 3D-FF50593CAS: 130406-30-3 | Min. 95% | - - - | Discontinued product |

Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2-phenylethyl]-, 9H-fluoren-9-ylmethyl ester
Ref: IN-DA000UDF
1g | 54.00 € | ||
5g | 109.00 € | ||
25g | 227.00 € |

Fmoc-D-Phenylalaninol
Ref: 3D-FF50593
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
500mg | Discontinued | Request information |