CAS 13042-39-2: Isosorbide 2-acetate
Description:Isosorbide 2-acetate, with the CAS number 13042-39-2, is an organic compound derived from isosorbide, a bicyclic sugar alcohol. It is characterized by the presence of an acetate group at the 2-position of the isosorbide structure, which enhances its solubility and reactivity. This compound typically appears as a colorless to pale yellow liquid with a mild odor. Isosorbide 2-acetate is known for its applications in the production of biodegradable polymers and as a plasticizer, owing to its favorable properties such as low volatility and good thermal stability. Additionally, it exhibits moderate polarity, making it useful in various chemical reactions and formulations. The compound is generally considered to have low toxicity, but like many chemicals, it should be handled with care, following appropriate safety guidelines. Its versatility in chemical synthesis and material science highlights its significance in both industrial and research settings.
Formula:C8H12O5
InChI:InChI=1S/C8H12O5/c1-4(9)13-6-3-12-7-5(10)2-11-8(6)7/h5-8,10H,2-3H2,1H3/t5-,6+,7-,8-/m1/s1
InChI key:InChIKey=ASUQMWUAFHPXOG-ULAWRXDQSA-N
SMILES:O=C(OC1COC2C(O)COC12)C
- Synonyms:
- 1,4:3,6-Dianhydro-<span class="text-smallcaps">D</span>-glucitol 2-acetate
- 1,4:3,6-Dianhydro-D-Glucitol 2-Acetate
- 2-O-acetyl-1,4:3,6-dianhydrohexitol
- <span class="text-smallcaps">D</span>-Glucitol, 1,4:3,6-dianhydro-, 2-acetate
- Furo[3,2-b]furan, <span class="text-smallcaps">D</span>-glucitol deriv.
- Glucitol, 1,4:3,6-dianhydro-, 2-acetate
- Glucitol, 1,4:3,6-dianhydro-, 2-acetate, <span class="text-smallcaps">D</span>-
- Isosorbide 2-acetate
- Glucitol, 1,4:3,6-dianhydro-, 2-acetate, D-
- D-Glucitol, 1,4:3,6-dianhydro-, 2-acetate
- See more synonyms
- Furo[3,2-b]furan, D-glucitol deriv.
![(3S,3aR,6R,6aR)-6-Hydroxyhexahydrofuro[3,2-b]furan-3-yl acetate](https://static.cymitquimica.com/products/10/thumb/F610334.jpg)
