CAS 1305324-67-7: 5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine

Description: 5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple substituents, including chlorine and iodine atoms, as well as methoxy groups, which contribute to its chemical reactivity and potential applications. The presence of the dimethoxymethyl group enhances its solubility and may influence its biological activity. The halogen substituents (chlorine and iodine) can significantly affect the compound's electronic properties, making it of interest in medicinal chemistry and material science. The compound's structure suggests potential uses in pharmaceuticals, particularly in the development of new drugs, due to the presence of functional groups that can participate in various chemical reactions. Additionally, its unique combination of elements may impart specific characteristics such as stability, reactivity, and interaction with biological targets. Overall, 5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine represents a complex molecule with diverse potential applications in various fields of chemistry.

Formula: C₉H₁₁ClINO₃

InChI: InChI=1S/C9H11ClINO3/c1-13-8-6(9(14-2)15-3)7(11)5(10)4-12-8/h4,9H,1-3H3

InChI key: InChIKey=CPBPIESCUUJZRD-UHFFFAOYSA-N

SMILES: ClC1=CN=C(OC)C(=C1I)C(OC)OC

Synonyms:

• 5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine
• Pyridine, 5-chloro-3-(dimethoxymethyl)-4-iodo-2-methoxy-

5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine

CAS: 1305324-67-7

• Purity: 98%
• Molecular weight: 343.54998779296875

5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine

CAS: 1305324-67-7

Please enquire for more information about 5-Chloro-3-(dimethoxymethyl)-4-iodo-2-methoxypyridine including the price, delivery time and more detailed …

• Formula: C₉H₁₁ClINO₃
• Purity: Min. 95%
• Molecular weight: 343.54 g/mol